C10H18F3NO2 — CID 151232274
butyl (3R)-3-amino-4,4,4-trifluoro-2,2-dimethylbutanoate (PubChem CID 151232274) has the molecular formula C10H18F3NO2 and a molecular weight of 241.25 g/mol. Its IUPAC name is butyl (3R)-3-amino-4,4,4-trifluoro-2,2-dimethylbutanoate.
| Compound Name | butyl (3R)-3-amino-4,4,4-trifluoro-2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 151232274 |
| Molecular Formula | C10H18F3NO2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | butyl (3R)-3-amino-4,4,4-trifluoro-2,2-dimethylbutanoate |
| SMILES | CCCCOC(=O)C(C)(C)[C@@H](N)C(F)(F)F |
| InChI | InChI=1S/C10H18F3NO2/c1-4-5-6-16-8(15)9(2,3)7(14)10(11,12)13/h7H,4-6,14H2,1-3H3/t7-/m1/s1 |
| InChIKey | NONRXPPTYFFXPW-SSDOTTSWSA-N |
| XLogP | 2.25 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|