C17H31NO7 — CID 141106294
tributyl 2-amino-2-hydroxyethane-1,1,1-tricarboxylate (PubChem CID 141106294) has the molecular formula C17H31NO7 and a molecular weight of 361.44 g/mol. Its IUPAC name is tributyl 2-amino-2-hydroxyethane-1,1,1-tricarboxylate.
| Compound Name | tributyl 2-amino-2-hydroxyethane-1,1,1-tricarboxylate |
|---|---|
| PubChem CID | 141106294 |
| Molecular Formula | C17H31NO7 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | tributyl 2-amino-2-hydroxyethane-1,1,1-tricarboxylate |
| SMILES | CCCCOC(=O)C(C(=O)OCCCC)(C(=O)OCCCC)C(N)O |
| InChI | InChI=1S/C17H31NO7/c1-4-7-10-23-14(20)17(13(18)19,15(21)24-11-8-5-2)16(22)25-12-9-6-3/h13,19H,4-12,18H2,1-3H3 |
| InChIKey | LPVMTPURJFBEJY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 125.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|