C14H30NO6P — CID 59105467
3-[hydroxy(oxidooxy)phosphoryl]propyl-dimethyl-[2-(2,2,3-trimethylbutanoyloxy)ethyl]azanium (PubChem CID 59105467) has the molecular formula C14H30NO6P and a molecular weight of 339.37 g/mol. Its IUPAC name is 3-[hydroxy(oxidooxy)phosphoryl]propyl-dimethyl-[2-(2,2,3-trimethylbutanoyloxy)ethyl]azanium.
| Compound Name | 3-[hydroxy(oxidooxy)phosphoryl]propyl-dimethyl-[2-(2,2,3-trimethylbutanoyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 59105467 |
| Molecular Formula | C14H30NO6P |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 3-[hydroxy(oxidooxy)phosphoryl]propyl-dimethyl-[2-(2,2,3-trimethylbutanoyloxy)ethyl]azanium |
| SMILES | CC(C)C(C)(C)C(=O)OCC[N+](C)(C)CCCP(=O)(O)O[O-] |
| InChI | InChI=1S/C14H30NO6P/c1-12(2)14(3,4)13(16)20-10-9-15(5,6)8-7-11-22(18,19)21-17/h12H,7-11H2,1-6H3,(H-,17,18,19) |
| InChIKey | RMGBFTNKOGBWOE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|