C13H25NO4 — CID 134252110
4-[2-(2,2-dimethylpropanoyloxy)ethyl-dimethylazaniumyl]butanoate (PubChem CID 134252110) has the molecular formula C13H25NO4 and a molecular weight of 259.35 g/mol. Its IUPAC name is 4-[2-(2,2-dimethylpropanoyloxy)ethyl-dimethylazaniumyl]butanoate.
| Compound Name | 4-[2-(2,2-dimethylpropanoyloxy)ethyl-dimethylazaniumyl]butanoate |
|---|---|
| PubChem CID | 134252110 |
| Molecular Formula | C13H25NO4 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 4-[2-(2,2-dimethylpropanoyloxy)ethyl-dimethylazaniumyl]butanoate |
| SMILES | CC(C)(C)C(=O)OCC[N+](C)(C)CCCC(=O)[O-] |
| InChI | InChI=1S/C13H25NO4/c1-13(2,3)12(17)18-10-9-14(4,5)8-6-7-11(15)16/h6-10H2,1-5H3 |
| InChIKey | JPJNTXGTABRMKC-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|