C9H16NO4- — CID 163539712
2-[2-(2,2-dimethylpropanoyloxy)ethylamino]acetate (PubChem CID 163539712) has the molecular formula C9H16NO4- and a molecular weight of 202.23 g/mol. Its IUPAC name is 2-[2-(2,2-dimethylpropanoyloxy)ethylamino]acetate.
| Compound Name | 2-[2-(2,2-dimethylpropanoyloxy)ethylamino]acetate |
|---|---|
| PubChem CID | 163539712 |
| Molecular Formula | C9H16NO4- |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2-[2-(2,2-dimethylpropanoyloxy)ethylamino]acetate |
| SMILES | CC(C)(C)C(=O)OCCNCC(=O)[O-] |
| InChI | InChI=1S/C9H17NO4/c1-9(2,3)8(13)14-5-4-10-6-7(11)12/h10H,4-6H2,1-3H3,(H,11,12)/p-1 |
| InChIKey | FABNOAYAPQUDED-UHFFFAOYSA-M |
| XLogP | -1.08 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|