C13H26N2O2 — CID 174656912
2-(piperidin-4-ylmethylamino)ethyl 2,2-dimethylpropanoate (PubChem CID 174656912) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 2-(piperidin-4-ylmethylamino)ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-(piperidin-4-ylmethylamino)ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174656912 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 2-(piperidin-4-ylmethylamino)ethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCCNCC1CCNCC1 |
| InChI | InChI=1S/C13H26N2O2/c1-13(2,3)12(16)17-9-8-15-10-11-4-6-14-7-5-11/h11,14-15H,4-10H2,1-3H3 |
| InChIKey | KDNUHJITMJATDD-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|