C12H23NO4 — CID 59031861
3-[(3-methoxy-3-oxopropyl)amino]propyl 2,2-dimethylpropanoate (PubChem CID 59031861) has the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. Its IUPAC name is 3-[(3-methoxy-3-oxopropyl)amino]propyl 2,2-dimethylpropanoate.
| Compound Name | 3-[(3-methoxy-3-oxopropyl)amino]propyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59031861 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 3-[(3-methoxy-3-oxopropyl)amino]propyl 2,2-dimethylpropanoate |
| SMILES | COC(=O)CCNCCCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C12H23NO4/c1-12(2,3)11(15)17-9-5-7-13-8-6-10(14)16-4/h13H,5-9H2,1-4H3 |
| InChIKey | SQINTOWKLQDTHC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|