C23H40O8 — CID 91593861
bis(2,2-dimethylpropanoyloxymethyl) undecanedioate (PubChem CID 91593861) has the molecular formula C23H40O8 and a molecular weight of 444.57 g/mol. Its IUPAC name is bis(2,2-dimethylpropanoyloxymethyl) undecanedioate.
| Compound Name | bis(2,2-dimethylpropanoyloxymethyl) undecanedioate |
|---|---|
| PubChem CID | 91593861 |
| Molecular Formula | C23H40O8 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | bis(2,2-dimethylpropanoyloxymethyl) undecanedioate |
| SMILES | CC(C)(C)C(=O)OCOC(=O)CCCCCCCCCC(=O)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C23H40O8/c1-22(2,3)20(26)30-16-28-18(24)14-12-10-8-7-9-11-13-15-19(25)29-17-31-21(27)23(4,5)6/h7-17H2,1-6H3 |
| InChIKey | AWBUYSGVIACHOM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|