About bis(methoxycarbonyloxymethyl) nonanedioate
bis(methoxycarbonyloxymethyl) nonanedioate (PubChem CID 90912615) has the molecular formula C15H24O10
and a molecular weight of 364.35 g/mol. Its IUPAC name is bis(methoxycarbonyloxymethyl) nonanedioate.
Molecular Properties
| Compound Name | bis(methoxycarbonyloxymethyl) nonanedioate |
| PubChem CID | 90912615 |
| Molecular Formula | C15H24O10 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | bis(methoxycarbonyloxymethyl) nonanedioate |
| SMILES | COC(=O)OCOC(=O)CCCCCCCC(=O)OCOC(=O)OC |
| InChI | InChI=1S/C15H24O10/c1-20-14(18)24-10-22-12(16)8-6-4-3-5-7-9-13(17)23-11-25-15(19)21-2/h3-11H2,1-2H3 |
| InChIKey | CXUOBEYSLRLTLM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze bis(methoxycarbonyloxymethyl) nonanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(methoxycarbonyloxymethyl) nonanedioate?
The IUPAC name of bis(methoxycarbonyloxymethyl) nonanedioate (CID 90912615) is bis(methoxycarbonyloxymethyl) nonanedioate.
What is the SMILES notation for bis(methoxycarbonyloxymethyl) nonanedioate?
The canonical SMILES for bis(methoxycarbonyloxymethyl) nonanedioate is COC(=O)OCOC(=O)CCCCCCCC(=O)OCOC(=O)OC.
What is the InChIKey of bis(methoxycarbonyloxymethyl) nonanedioate?
The InChIKey is CXUOBEYSLRLTLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O10/c1-20-14(18)24-10-22-12(16)8-6-4-3-5-7-9-13(17)23-11-25-15(19)21-2/h3-11H2,1-2H3.
What are the key properties of bis(methoxycarbonyloxymethyl) nonanedioate?
bis(methoxycarbonyloxymethyl) nonanedioate has a molecular weight of 364.35 g/mol, XLogP of 2.28, 12 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(methoxycarbonyloxymethyl) nonanedioate is sourced from PubChem (CID 90912615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).