C10H19NaO4 — CID 175483775
sodium;butanoyloxymethyl 2,2-dimethylpropanoate;hydride (PubChem CID 175483775) has the molecular formula C10H19NaO4 and a molecular weight of 226.25 g/mol. Its IUPAC name is sodium;butanoyloxymethyl 2,2-dimethylpropanoate;hydride.
| Compound Name | sodium;butanoyloxymethyl 2,2-dimethylpropanoate;hydride |
|---|---|
| PubChem CID | 175483775 |
| Molecular Formula | C10H19NaO4 |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | sodium;butanoyloxymethyl 2,2-dimethylpropanoate;hydride |
| SMILES | CCCC(=O)OCOC(=O)C(C)(C)C.[H-].[Na+] |
| InChI | InChI=1S/C10H18O4.Na.H/c1-5-6-8(11)13-7-14-9(12)10(2,3)4;;/h5-7H2,1-4H3;;/q;+1;-1 |
| InChIKey | GLYDEXAYYSCOBG-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|