C13H22O5 — CID 123362977
2,2-dimethylpropanoyloxymethyl 4-ethoxypent-4-enoate (PubChem CID 123362977) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl 4-ethoxypent-4-enoate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl 4-ethoxypent-4-enoate |
|---|---|
| PubChem CID | 123362977 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl 4-ethoxypent-4-enoate |
| SMILES | C=C(CCC(=O)OCOC(=O)C(C)(C)C)OCC |
| InChI | InChI=1S/C13H22O5/c1-6-16-10(2)7-8-11(14)17-9-18-12(15)13(3,4)5/h2,6-9H2,1,3-5H3 |
| InChIKey | NKHDCJUDXWHFNK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|