C23H47O6P — CID 177053477
ethane;ethyl 4-[[2,2-dimethylpropanoyloxymethoxy(methyl)phosphanyl]methyl]-5-ethoxyhex-5-enoate;propane (PubChem CID 177053477) has the molecular formula C23H47O6P and a molecular weight of 450.60 g/mol. Its IUPAC name is ethane;ethyl 4-[[2,2-dimethylpropanoyloxymethoxy(methyl)phosphanyl]methyl]-5-ethoxyhex-5-enoate;propane.
| Compound Name | ethane;ethyl 4-[[2,2-dimethylpropanoyloxymethoxy(methyl)phosphanyl]methyl]-5-ethoxyhex-5-enoate;propane |
|---|---|
| PubChem CID | 177053477 |
| Molecular Formula | C23H47O6P |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.31 |
| IUPAC Name | ethane;ethyl 4-[[2,2-dimethylpropanoyloxymethoxy(methyl)phosphanyl]methyl]-5-ethoxyhex-5-enoate;propane |
| SMILES | C=C(OCC)C(CCC(=O)OCC)CP(C)OCOC(=O)C(C)(C)C.CC.CCC |
| InChI | InChI=1S/C18H33O6P.C3H8.C2H6/c1-8-21-14(3)15(10-11-16(19)22-9-2)12-25(7)24-13-23-17(20)18(4,5)6;1-3-2;1-2/h15H,3,8-13H2,1-2,4-7H3;3H2,1-2H3;1-2H3 |
| InChIKey | LXXUEXWYLWITHD-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|