About ethyl 3-silylpropanoate
ethyl 3-silylpropanoate (PubChem CID 123980878) has the molecular formula C5H12O2Si
and a molecular weight of 132.24 g/mol. Its IUPAC name is ethyl 3-silylpropanoate.
Molecular Properties
| Compound Name | ethyl 3-silylpropanoate |
| PubChem CID | 123980878 |
| Molecular Formula | C5H12O2Si |
| Molecular Weight | 132.24 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | ethyl 3-silylpropanoate |
| SMILES | CCOC(=O)CC[SiH3] |
| InChI | InChI=1S/C5H12O2Si/c1-2-7-5(6)3-4-8/h2-4H2,1,8H3 |
| InChIKey | IDSYLNVXAHIWGM-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.24 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-silylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-silylpropanoate?
The IUPAC name of ethyl 3-silylpropanoate (CID 123980878) is ethyl 3-silylpropanoate.
What is the SMILES notation for ethyl 3-silylpropanoate?
The canonical SMILES for ethyl 3-silylpropanoate is CCOC(=O)CC[SiH3].
What is the InChIKey of ethyl 3-silylpropanoate?
The InChIKey is IDSYLNVXAHIWGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O2Si/c1-2-7-5(6)3-4-8/h2-4H2,1,8H3.
What are the key properties of ethyl 3-silylpropanoate?
ethyl 3-silylpropanoate has a molecular weight of 132.24 g/mol, XLogP of -0.28, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-silylpropanoate is sourced from PubChem (CID 123980878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).