C10H25N3O3 — CID 145424099
aminooxymethyl 2,2-dimethylpropanoate;1,1-diethylhydrazine (PubChem CID 145424099) has the molecular formula C10H25N3O3 and a molecular weight of 235.33 g/mol. Its IUPAC name is aminooxymethyl 2,2-dimethylpropanoate;1,1-diethylhydrazine.
| Compound Name | aminooxymethyl 2,2-dimethylpropanoate;1,1-diethylhydrazine |
|---|---|
| PubChem CID | 145424099 |
| Molecular Formula | C10H25N3O3 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | aminooxymethyl 2,2-dimethylpropanoate;1,1-diethylhydrazine |
| SMILES | CC(C)(C)C(=O)OCON.CCN(N)CC |
| InChI | InChI=1S/C6H13NO3.C4H12N2/c1-6(2,3)5(8)9-4-10-7;1-3-6(5)4-2/h4,7H2,1-3H3;3-5H2,1-2H3 |
| InChIKey | SMYZLAYUQUKZPU-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|