About 2,2-dimethylpropanoyloxymethyl (E)-6,6-dimethyl-5-oxohept-3-enoate
2,2-dimethylpropanoyloxymethyl (E)-6,6-dimethyl-5-oxohept-3-enoate (PubChem CID 90394266) has the molecular formula C15H24O5
and a molecular weight of 284.35 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (E)-6,6-dimethyl-5-oxohept-3-enoate.
Molecular Properties
| Compound Name | 2,2-dimethylpropanoyloxymethyl (E)-6,6-dimethyl-5-oxohept-3-enoate |
| PubChem CID | 90394266 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (E)-6,6-dimethyl-5-oxohept-3-enoate |
| SMILES | CC(C)(C)C(=O)/C=C/CC(=O)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C15H24O5/c1-14(2,3)11(16)8-7-9-12(17)19-10-20-13(18)15(4,5)6/h7-8H,9-10H2,1-6H3/b8-7+ |
| InChIKey | WSDZFZHBDOABDW-BQYQJAHWSA-N |
| XLogP | 2.64 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylpropanoyloxymethyl (E)-6,6-dimethyl-5-oxohept-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropanoyloxymethyl (E)-6,6-dimethyl-5-oxohept-3-enoate?
The IUPAC name of 2,2-dimethylpropanoyloxymethyl (E)-6,6-dimethyl-5-oxohept-3-enoate (CID 90394266) is 2,2-dimethylpropanoyloxymethyl (E)-6,6-dimethyl-5-oxohept-3-enoate.
What is the SMILES notation for 2,2-dimethylpropanoyloxymethyl (E)-6,6-dimethyl-5-oxohept-3-enoate?
The canonical SMILES for 2,2-dimethylpropanoyloxymethyl (E)-6,6-dimethyl-5-oxohept-3-enoate is CC(C)(C)C(=O)/C=C/CC(=O)OCOC(=O)C(C)(C)C.
What is the InChIKey of 2,2-dimethylpropanoyloxymethyl (E)-6,6-dimethyl-5-oxohept-3-enoate?
The InChIKey is WSDZFZHBDOABDW-BQYQJAHWSA-N. The full InChI is InChI=1S/C15H24O5/c1-14(2,3)11(16)8-7-9-12(17)19-10-20-13(18)15(4,5)6/h7-8H,9-10H2,1-6H3/b8-7+.
What are the key properties of 2,2-dimethylpropanoyloxymethyl (E)-6,6-dimethyl-5-oxohept-3-enoate?
2,2-dimethylpropanoyloxymethyl (E)-6,6-dimethyl-5-oxohept-3-enoate has a molecular weight of 284.35 g/mol, XLogP of 2.64, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropanoyloxymethyl (E)-6,6-dimethyl-5-oxohept-3-enoate is sourced from PubChem (CID 90394266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).