C10H17NO3 — CID 167093318
2-(prop-2-enoylamino)ethyl 2,2-dimethylpropanoate (PubChem CID 167093318) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-(prop-2-enoylamino)ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-(prop-2-enoylamino)ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 167093318 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 2-(prop-2-enoylamino)ethyl 2,2-dimethylpropanoate |
| SMILES | C=CC(=O)NCCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C10H17NO3/c1-5-8(12)11-6-7-14-9(13)10(2,3)4/h5H,1,6-7H2,2-4H3,(H,11,12) |
| InChIKey | AXBXQMSWKZREFV-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|