C14H27NO4 — CID 176647892
3-[3-(2,2-dimethylbutanoyloxy)propyl-dimethylazaniumyl]propanoate (PubChem CID 176647892) has the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. Its IUPAC name is 3-[3-(2,2-dimethylbutanoyloxy)propyl-dimethylazaniumyl]propanoate.
| Compound Name | 3-[3-(2,2-dimethylbutanoyloxy)propyl-dimethylazaniumyl]propanoate |
|---|---|
| PubChem CID | 176647892 |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | 3-[3-(2,2-dimethylbutanoyloxy)propyl-dimethylazaniumyl]propanoate |
| SMILES | CCC(C)(C)C(=O)OCCC[N+](C)(C)CCC(=O)[O-] |
| InChI | InChI=1S/C14H27NO4/c1-6-14(2,3)13(18)19-11-7-9-15(4,5)10-8-12(16)17/h6-11H2,1-5H3 |
| InChIKey | LTNZESAUBFRKSX-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|