C13H26N2O3 — CID 123669324
3-[2-(2,2-dimethylbutanoylamino)ethyl-dimethylazaniumyl]propanoate (PubChem CID 123669324) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is 3-[2-(2,2-dimethylbutanoylamino)ethyl-dimethylazaniumyl]propanoate.
| Compound Name | 3-[2-(2,2-dimethylbutanoylamino)ethyl-dimethylazaniumyl]propanoate |
|---|---|
| PubChem CID | 123669324 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 3-[2-(2,2-dimethylbutanoylamino)ethyl-dimethylazaniumyl]propanoate |
| SMILES | CCC(C)(C)C(=O)NCC[N+](C)(C)CCC(=O)[O-] |
| InChI | InChI=1S/C13H26N2O3/c1-6-13(2,3)12(18)14-8-10-15(4,5)9-7-11(16)17/h6-10H2,1-5H3,(H-,14,16,17,18) |
| InChIKey | QPKLFPCOQIIPRQ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|