C21H40NO6S+ — CID 172897779
2-[5-butoxy-2-[(3-methoxy-3-oxopropyl)sulfanylmethyl]-2,4-dimethyl-5-oxopentanoyl]oxyethyl-trimethylazanium (PubChem CID 172897779) has the molecular formula C21H40NO6S+ and a molecular weight of 434.62 g/mol. Its IUPAC name is 2-[5-butoxy-2-[(3-methoxy-3-oxopropyl)sulfanylmethyl]-2,4-dimethyl-5-oxopentanoyl]oxyethyl-trimethylazanium.
| Compound Name | 2-[5-butoxy-2-[(3-methoxy-3-oxopropyl)sulfanylmethyl]-2,4-dimethyl-5-oxopentanoyl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 172897779 |
| Molecular Formula | C21H40NO6S+ |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | 2-[5-butoxy-2-[(3-methoxy-3-oxopropyl)sulfanylmethyl]-2,4-dimethyl-5-oxopentanoyl]oxyethyl-trimethylazanium |
| SMILES | CCCCOC(=O)C(C)CC(C)(CSCCC(=O)OC)C(=O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C21H40NO6S/c1-8-9-12-27-19(24)17(2)15-21(3,16-29-14-10-18(23)26-7)20(25)28-13-11-22(4,5)6/h17H,8-16H2,1-7H3/q+1 |
| InChIKey | OBFPKIYWMMWNQH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|