C15H29NO7S — CID 90223739
2-[[4-(2-hydroxyethoxycarbonyl)-2,4-dimethylhexanoyl]amino]-2-methylpropane-1-sulfonic acid (PubChem CID 90223739) has the molecular formula C15H29NO7S and a molecular weight of 367.46 g/mol. Its IUPAC name is 2-[[4-(2-hydroxyethoxycarbonyl)-2,4-dimethylhexanoyl]amino]-2-methylpropane-1-sulfonic acid.
| Compound Name | 2-[[4-(2-hydroxyethoxycarbonyl)-2,4-dimethylhexanoyl]amino]-2-methylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 90223739 |
| Molecular Formula | C15H29NO7S |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 2-[[4-(2-hydroxyethoxycarbonyl)-2,4-dimethylhexanoyl]amino]-2-methylpropane-1-sulfonic acid |
| SMILES | CCC(C)(CC(C)C(=O)NC(C)(C)CS(=O)(=O)O)C(=O)OCCO |
| InChI | InChI=1S/C15H29NO7S/c1-6-15(5,13(19)23-8-7-17)9-11(2)12(18)16-14(3,4)10-24(20,21)22/h11,17H,6-10H2,1-5H3,(H,16,18)(H,20,21,22) |
| InChIKey | SIIBDERBYDVCPC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|