C24H50N2O7S — CID 90771969
N-(1,1-dihydroxyundecan-2-yl)-2-ethyl-2,4-dimethyl-N'-[2-methyl-1-(trihydroxy-λ4-sulfanyl)propan-2-yl]pentanediamide (PubChem CID 90771969) has the molecular formula C24H50N2O7S and a molecular weight of 510.74 g/mol. Its IUPAC name is N-(1,1-dihydroxyundecan-2-yl)-2-ethyl-2,4-dimethyl-N'-[2-methyl-1-(trihydroxy-λ4-sulfanyl)propan-2-yl]pentanediamide.
| Compound Name | N-(1,1-dihydroxyundecan-2-yl)-2-ethyl-2,4-dimethyl-N'-[2-methyl-1-(trihydroxy-λ4-sulfanyl)propan-2-yl]pentanediamide |
|---|---|
| PubChem CID | 90771969 |
| Molecular Formula | C24H50N2O7S |
| Molecular Weight | 510.74 g/mol |
| Exact Mass | 510.33 |
| IUPAC Name | N-(1,1-dihydroxyundecan-2-yl)-2-ethyl-2,4-dimethyl-N'-[2-methyl-1-(trihydroxy-λ4-sulfanyl)propan-2-yl]pentanediamide |
| SMILES | CCCCCCCCCC(NC(=O)C(C)(CC)CC(C)C(=O)NC(C)(C)CS(O)(O)O)C(O)O |
| InChI | InChI=1S/C24H50N2O7S/c1-7-9-10-11-12-13-14-15-19(21(28)29)25-22(30)24(6,8-2)16-18(3)20(27)26-23(4,5)17-34(31,32)33/h18-19,21,28-29,31-33H,7-17H2,1-6H3,(H,25,30)(H,26,27) |
| InChIKey | LOEZGKFVBOVSRT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 159.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.74 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|