C15H31NO4S — CID 134415224
2-[(2-ethyl-2-methyloctanoyl)amino]-2-methylpropane-1-sulfonic acid (PubChem CID 134415224) has the molecular formula C15H31NO4S and a molecular weight of 321.48 g/mol. Its IUPAC name is 2-[(2-ethyl-2-methyloctanoyl)amino]-2-methylpropane-1-sulfonic acid.
| Compound Name | 2-[(2-ethyl-2-methyloctanoyl)amino]-2-methylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 134415224 |
| Molecular Formula | C15H31NO4S |
| Molecular Weight | 321.48 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 2-[(2-ethyl-2-methyloctanoyl)amino]-2-methylpropane-1-sulfonic acid |
| SMILES | CCCCCCC(C)(CC)C(=O)NC(C)(C)CS(=O)(=O)O |
| InChI | InChI=1S/C15H31NO4S/c1-6-8-9-10-11-15(5,7-2)13(17)16-14(3,4)12-21(18,19)20/h6-12H2,1-5H3,(H,16,17)(H,18,19,20) |
| InChIKey | QLRBAQQTHLVXLZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|