C15H31NO4S2 — CID 88832156
2-methyl-2-(3-octylsulfanylpropanoylamino)propane-1-sulfonic acid (PubChem CID 88832156) has the molecular formula C15H31NO4S2 and a molecular weight of 353.55 g/mol. Its IUPAC name is 2-methyl-2-(3-octylsulfanylpropanoylamino)propane-1-sulfonic acid.
| Compound Name | 2-methyl-2-(3-octylsulfanylpropanoylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 88832156 |
| Molecular Formula | C15H31NO4S2 |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 2-methyl-2-(3-octylsulfanylpropanoylamino)propane-1-sulfonic acid |
| SMILES | CCCCCCCCSCCC(=O)NC(C)(C)CS(=O)(=O)O |
| InChI | InChI=1S/C15H31NO4S2/c1-4-5-6-7-8-9-11-21-12-10-14(17)16-15(2,3)13-22(18,19)20/h4-13H2,1-3H3,(H,16,17)(H,18,19,20) |
| InChIKey | OEAFXAZUQGELGI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|