C20H39NO6S2 — CID 20802114
2-[3-(9-methoxy-11-oxododecyl)sulfanylpropanoylamino]-2-methylpropane-1-sulfonic acid (PubChem CID 20802114) has the molecular formula C20H39NO6S2 and a molecular weight of 453.67 g/mol. Its IUPAC name is 2-[3-(9-methoxy-11-oxododecyl)sulfanylpropanoylamino]-2-methylpropane-1-sulfonic acid.
| Compound Name | 2-[3-(9-methoxy-11-oxododecyl)sulfanylpropanoylamino]-2-methylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 20802114 |
| Molecular Formula | C20H39NO6S2 |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 2-[3-(9-methoxy-11-oxododecyl)sulfanylpropanoylamino]-2-methylpropane-1-sulfonic acid |
| SMILES | COC(CCCCCCCCSCCC(=O)NC(C)(C)CS(=O)(=O)O)CC(C)=O |
| InChI | InChI=1S/C20H39NO6S2/c1-17(22)15-18(27-4)11-9-7-5-6-8-10-13-28-14-12-19(23)21-20(2,3)16-29(24,25)26/h18H,5-16H2,1-4H3,(H,21,23)(H,24,25,26) |
| InChIKey | CTRCDISBIJCKED-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|