C17H35N3O10S2 — CID 101427005
2-methyl-2-[3-[[methyl-[[3-[(2-methyl-1-sulfopropan-2-yl)amino]-3-oxopropoxy]methyl]amino]methoxy]propanoylamino]propane-1-sulfonic acid (PubChem CID 101427005) has the molecular formula C17H35N3O10S2 and a molecular weight of 505.61 g/mol. Its IUPAC name is 2-methyl-2-[3-[[methyl-[[3-[(2-methyl-1-sulfopropan-2-yl)amino]-3-oxopropoxy]methyl]amino]methoxy]propanoylamino]propane-1-sulfonic acid.
| Compound Name | 2-methyl-2-[3-[[methyl-[[3-[(2-methyl-1-sulfopropan-2-yl)amino]-3-oxopropoxy]methyl]amino]methoxy]propanoylamino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 101427005 |
| Molecular Formula | C17H35N3O10S2 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 2-methyl-2-[3-[[methyl-[[3-[(2-methyl-1-sulfopropan-2-yl)amino]-3-oxopropoxy]methyl]amino]methoxy]propanoylamino]propane-1-sulfonic acid |
| SMILES | CN(COCCC(=O)NC(C)(C)CS(=O)(=O)O)COCCC(=O)NC(C)(C)CS(=O)(=O)O |
| InChI | InChI=1S/C17H35N3O10S2/c1-16(2,10-31(23,24)25)18-14(21)6-8-29-12-20(5)13-30-9-7-15(22)19-17(3,4)11-32(26,27)28/h6-13H2,1-5H3,(H,18,21)(H,19,22)(H,23,24,25)(H,26,27,28) |
| InChIKey | PKLYOEQFZLGPAM-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 188.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|