C27H51NO6S2 — CID 89264161
2-methyl-2-[3-[1-[(Z)-octadec-9-enyl]peroxyethenylsulfanyl]propanoylamino]propane-1-sulfonic acid (PubChem CID 89264161) has the molecular formula C27H51NO6S2 and a molecular weight of 549.84 g/mol. Its IUPAC name is 2-methyl-2-[3-[1-[(Z)-octadec-9-enyl]peroxyethenylsulfanyl]propanoylamino]propane-1-sulfonic acid.
| Compound Name | 2-methyl-2-[3-[1-[(Z)-octadec-9-enyl]peroxyethenylsulfanyl]propanoylamino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 89264161 |
| Molecular Formula | C27H51NO6S2 |
| Molecular Weight | 549.84 g/mol |
| Exact Mass | 549.32 |
| IUPAC Name | 2-methyl-2-[3-[1-[(Z)-octadec-9-enyl]peroxyethenylsulfanyl]propanoylamino]propane-1-sulfonic acid |
| SMILES | C=C(OOCCCCCCCC/C=C\CCCCCCCC)SCCC(=O)NC(C)(C)CS(=O)(=O)O |
| InChI | InChI=1S/C27H51NO6S2/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-33-34-25(2)35-23-21-26(29)28-27(3,4)24-36(30,31)32/h12-13H,2,5-11,14-24H2,1,3-4H3,(H,28,29)(H,30,31,32)/b13-12- |
| InChIKey | VVRNWKXNFRPYNO-SEYXRHQNSA-N |
| XLogP | 7.35 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.84 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|