C10H21NO4S — CID 147723036
2-methyl-2-(4-methylpentanoylamino)propane-1-sulfonic acid (PubChem CID 147723036) has the molecular formula C10H21NO4S and a molecular weight of 251.35 g/mol. Its IUPAC name is 2-methyl-2-(4-methylpentanoylamino)propane-1-sulfonic acid.
| Compound Name | 2-methyl-2-(4-methylpentanoylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 147723036 |
| Molecular Formula | C10H21NO4S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 2-methyl-2-(4-methylpentanoylamino)propane-1-sulfonic acid |
| SMILES | CC(C)CCC(=O)NC(C)(C)CS(=O)(=O)O |
| InChI | InChI=1S/C10H21NO4S/c1-8(2)5-6-9(12)11-10(3,4)7-16(13,14)15/h8H,5-7H2,1-4H3,(H,11,12)(H,13,14,15) |
| InChIKey | GWYHQQFAVSRIDZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|