C15H26N2O6S — CID 23394734
4-cyano-2-methyl-2-[3-[(2-methyl-1-sulfopropan-2-yl)amino]-3-oxopropyl]hexanoic acid (PubChem CID 23394734) has the molecular formula C15H26N2O6S and a molecular weight of 362.45 g/mol. Its IUPAC name is 4-cyano-2-methyl-2-[3-[(2-methyl-1-sulfopropan-2-yl)amino]-3-oxopropyl]hexanoic acid.
| Compound Name | 4-cyano-2-methyl-2-[3-[(2-methyl-1-sulfopropan-2-yl)amino]-3-oxopropyl]hexanoic acid |
|---|---|
| PubChem CID | 23394734 |
| Molecular Formula | C15H26N2O6S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 4-cyano-2-methyl-2-[3-[(2-methyl-1-sulfopropan-2-yl)amino]-3-oxopropyl]hexanoic acid |
| SMILES | CCC(C#N)CC(C)(CCC(=O)NC(C)(C)CS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C15H26N2O6S/c1-5-11(9-16)8-15(4,13(19)20)7-6-12(18)17-14(2,3)10-24(21,22)23/h11H,5-8,10H2,1-4H3,(H,17,18)(H,19,20)(H,21,22,23) |
| InChIKey | VEZYUCBPBQXXCB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 144.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|