C21H42N2O7S — CID 58526093
2-[[4-(tert-butylcarbamoyl)-6-hydroxy-2-(2-hydroxybutyl)octanoyl]amino]-2-methylpropane-1-sulfonic acid (PubChem CID 58526093) has the molecular formula C21H42N2O7S and a molecular weight of 466.64 g/mol. Its IUPAC name is 2-[[4-(tert-butylcarbamoyl)-6-hydroxy-2-(2-hydroxybutyl)octanoyl]amino]-2-methylpropane-1-sulfonic acid.
| Compound Name | 2-[[4-(tert-butylcarbamoyl)-6-hydroxy-2-(2-hydroxybutyl)octanoyl]amino]-2-methylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58526093 |
| Molecular Formula | C21H42N2O7S |
| Molecular Weight | 466.64 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | 2-[[4-(tert-butylcarbamoyl)-6-hydroxy-2-(2-hydroxybutyl)octanoyl]amino]-2-methylpropane-1-sulfonic acid |
| SMILES | CCC(O)CC(CC(CC(O)CC)C(=O)NC(C)(C)CS(=O)(=O)O)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C21H42N2O7S/c1-8-16(24)11-14(18(26)22-20(3,4)5)10-15(12-17(25)9-2)19(27)23-21(6,7)13-31(28,29)30/h14-17,24-25H,8-13H2,1-7H3,(H,22,26)(H,23,27)(H,28,29,30) |
| InChIKey | RPHJNMTZOIEBHZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.64 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|