C13H27NO4S — CID 170108778
2-(2-tert-butylpentanoylamino)-2-methylpropane-1-sulfonic acid (PubChem CID 170108778) has the molecular formula C13H27NO4S and a molecular weight of 293.43 g/mol. Its IUPAC name is 2-(2-tert-butylpentanoylamino)-2-methylpropane-1-sulfonic acid.
| Compound Name | 2-(2-tert-butylpentanoylamino)-2-methylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 170108778 |
| Molecular Formula | C13H27NO4S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 2-(2-tert-butylpentanoylamino)-2-methylpropane-1-sulfonic acid |
| SMILES | CCCC(C(=O)NC(C)(C)CS(=O)(=O)O)C(C)(C)C |
| InChI | InChI=1S/C13H27NO4S/c1-7-8-10(12(2,3)4)11(15)14-13(5,6)9-19(16,17)18/h10H,7-9H2,1-6H3,(H,14,15)(H,16,17,18) |
| InChIKey | FIHCOJVXBMPBRL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|