C30H60N2O5S — CID 126640971
2-[[2-(2,3-dimethylbutan-2-yl)-6-(dimethylcarbamoyl)-4,4,5,5,8,8,9-heptamethyldecanoyl]amino]-2-methylpropane-1-sulfonic acid (PubChem CID 126640971) has the molecular formula C30H60N2O5S and a molecular weight of 560.89 g/mol. Its IUPAC name is 2-[[2-(2,3-dimethylbutan-2-yl)-6-(dimethylcarbamoyl)-4,4,5,5,8,8,9-heptamethyldecanoyl]amino]-2-methylpropane-1-sulfonic acid.
| Compound Name | 2-[[2-(2,3-dimethylbutan-2-yl)-6-(dimethylcarbamoyl)-4,4,5,5,8,8,9-heptamethyldecanoyl]amino]-2-methylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 126640971 |
| Molecular Formula | C30H60N2O5S |
| Molecular Weight | 560.89 g/mol |
| Exact Mass | 560.42 |
| IUPAC Name | 2-[[2-(2,3-dimethylbutan-2-yl)-6-(dimethylcarbamoyl)-4,4,5,5,8,8,9-heptamethyldecanoyl]amino]-2-methylpropane-1-sulfonic acid |
| SMILES | CC(C)C(C)(C)CC(C(=O)N(C)C)C(C)(C)C(C)(C)CC(C(=O)NC(C)(C)CS(=O)(=O)O)C(C)(C)C(C)C |
| InChI | InChI=1S/C30H60N2O5S/c1-20(2)26(5,6)17-23(25(34)32(15)16)30(13,14)27(7,8)18-22(29(11,12)21(3)4)24(33)31-28(9,10)19-38(35,36)37/h20-23H,17-19H2,1-16H3,(H,31,33)(H,35,36,37) |
| InChIKey | VZDXOQMEGBUHEC-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.89 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|