C10H23N2O4S+ — CID 3097426
trimethyl-[3-[(2-methyl-1-sulfopropan-2-yl)amino]-3-oxopropyl]azanium (PubChem CID 3097426) has the molecular formula C10H23N2O4S+ and a molecular weight of 267.37 g/mol. Its IUPAC name is trimethyl-[3-[(2-methyl-1-sulfopropan-2-yl)amino]-3-oxopropyl]azanium.
| Compound Name | trimethyl-[3-[(2-methyl-1-sulfopropan-2-yl)amino]-3-oxopropyl]azanium |
|---|---|
| PubChem CID | 3097426 |
| Molecular Formula | C10H23N2O4S+ |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | trimethyl-[3-[(2-methyl-1-sulfopropan-2-yl)amino]-3-oxopropyl]azanium |
| SMILES | CC(C)(CS(=O)(=O)O)NC(=O)CC[N+](C)(C)C |
| InChI | InChI=1S/C10H22N2O4S/c1-10(2,8-17(14,15)16)11-9(13)6-7-12(3,4)5/h6-8H2,1-5H3,(H-,11,13,14,15,16)/p+1 |
| InChIKey | ZVIPEBRHXIIYCQ-UHFFFAOYSA-O |
| XLogP | -0.13 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|