C23H36N2O12S2 — CID 158147524
2-methyl-2-[3-[2-(4-prop-2-enoyloxybutanoyloxy)-3-(2-prop-2-enoyloxyethylcarbamoyloxy)propyl]sulfanylpropanoylamino]propane-1-sulfonic acid (PubChem CID 158147524) has the molecular formula C23H36N2O12S2 and a molecular weight of 596.68 g/mol. Its IUPAC name is 2-methyl-2-[3-[2-(4-prop-2-enoyloxybutanoyloxy)-3-(2-prop-2-enoyloxyethylcarbamoyloxy)propyl]sulfanylpropanoylamino]propane-1-sulfonic acid.
| Compound Name | 2-methyl-2-[3-[2-(4-prop-2-enoyloxybutanoyloxy)-3-(2-prop-2-enoyloxyethylcarbamoyloxy)propyl]sulfanylpropanoylamino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 158147524 |
| Molecular Formula | C23H36N2O12S2 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | 2-methyl-2-[3-[2-(4-prop-2-enoyloxybutanoyloxy)-3-(2-prop-2-enoyloxyethylcarbamoyloxy)propyl]sulfanylpropanoylamino]propane-1-sulfonic acid |
| SMILES | C=CC(=O)OCCCC(=O)OC(COC(=O)NCCOC(=O)C=C)CSCCC(=O)NC(C)(C)CS(=O)(=O)O |
| InChI | InChI=1S/C23H36N2O12S2/c1-5-19(27)34-11-7-8-21(29)37-17(14-36-22(30)24-10-12-35-20(28)6-2)15-38-13-9-18(26)25-23(3,4)16-39(31,32)33/h5-6,17H,1-2,7-16H2,3-4H3,(H,24,30)(H,25,26)(H,31,32,33) |
| InChIKey | PPBWWYSATVHKDP-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 200.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|