C18H27NO8 — CID 159154859
1-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]propan-2-yl 4-(2-methylprop-2-enoyloxy)butanoate (PubChem CID 159154859) has the molecular formula C18H27NO8 and a molecular weight of 385.41 g/mol. Its IUPAC name is 1-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]propan-2-yl 4-(2-methylprop-2-enoyloxy)butanoate.
| Compound Name | 1-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]propan-2-yl 4-(2-methylprop-2-enoyloxy)butanoate |
|---|---|
| PubChem CID | 159154859 |
| Molecular Formula | C18H27NO8 |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 1-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]propan-2-yl 4-(2-methylprop-2-enoyloxy)butanoate |
| SMILES | C=C(C)C(=O)OCCCC(=O)OC(C)COC(=O)NCCOC(=O)C(=C)C |
| InChI | InChI=1S/C18H27NO8/c1-12(2)16(21)24-9-6-7-15(20)27-14(5)11-26-18(23)19-8-10-25-17(22)13(3)4/h14H,1,3,6-11H2,2,4-5H3,(H,19,23) |
| InChIKey | KJTKIIUYIRPKAU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|