C12H20NO8P — CID 122396505
[5-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]-2-oxopentyl]phosphonic acid (PubChem CID 122396505) has the molecular formula C12H20NO8P and a molecular weight of 337.27 g/mol. Its IUPAC name is [5-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]-2-oxopentyl]phosphonic acid.
| Compound Name | [5-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]-2-oxopentyl]phosphonic acid |
|---|---|
| PubChem CID | 122396505 |
| Molecular Formula | C12H20NO8P |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | [5-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]-2-oxopentyl]phosphonic acid |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCCC(=O)CP(=O)(O)O |
| InChI | InChI=1S/C12H20NO8P/c1-9(2)11(15)20-7-5-13-12(16)21-6-3-4-10(14)8-22(17,18)19/h1,3-8H2,2H3,(H,13,16)(H2,17,18,19) |
| InChIKey | LJRGWAXHCZXXSC-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|