C21H33NO8S2 — CID 157246062
2-[2-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethylsulfanyl]ethylsulfanyl]ethyl 4-(2-methylprop-2-enoyloxy)butanoate (PubChem CID 157246062) has the molecular formula C21H33NO8S2 and a molecular weight of 491.63 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethylsulfanyl]ethylsulfanyl]ethyl 4-(2-methylprop-2-enoyloxy)butanoate.
| Compound Name | 2-[2-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethylsulfanyl]ethylsulfanyl]ethyl 4-(2-methylprop-2-enoyloxy)butanoate |
|---|---|
| PubChem CID | 157246062 |
| Molecular Formula | C21H33NO8S2 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 2-[2-[2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]ethylsulfanyl]ethylsulfanyl]ethyl 4-(2-methylprop-2-enoyloxy)butanoate |
| SMILES | C=C(C)C(=O)OCCCC(=O)OCCSCCSCCOC(=O)NCCOC(=O)C(=C)C |
| InChI | InChI=1S/C21H33NO8S2/c1-16(2)19(24)28-8-5-6-18(23)27-10-12-31-14-15-32-13-11-30-21(26)22-7-9-29-20(25)17(3)4/h1,3,5-15H2,2,4H3,(H,22,26) |
| InChIKey | LYMYHXICMISXFU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|