C23H31NO12S — CID 90322729
4-[1-[3-[1-(2-methylprop-2-enoyloxy)ethenoxy]-3-oxopropyl]sulfanyl-3-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]propan-2-yl]oxy-4-oxobutanoic acid (PubChem CID 90322729) has the molecular formula C23H31NO12S and a molecular weight of 545.56 g/mol. Its IUPAC name is 4-[1-[3-[1-(2-methylprop-2-enoyloxy)ethenoxy]-3-oxopropyl]sulfanyl-3-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]propan-2-yl]oxy-4-oxobutanoic acid.
| Compound Name | 4-[1-[3-[1-(2-methylprop-2-enoyloxy)ethenoxy]-3-oxopropyl]sulfanyl-3-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]propan-2-yl]oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 90322729 |
| Molecular Formula | C23H31NO12S |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | 4-[1-[3-[1-(2-methylprop-2-enoyloxy)ethenoxy]-3-oxopropyl]sulfanyl-3-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]propan-2-yl]oxy-4-oxobutanoic acid |
| SMILES | C=C(OC(=O)CCSCC(COC(=O)NCCOC(=O)C(=C)C)OC(=O)CCC(=O)O)OC(=O)C(=C)C |
| InChI | InChI=1S/C23H31NO12S/c1-14(2)21(29)32-10-9-24-23(31)33-12-17(36-19(27)7-6-18(25)26)13-37-11-8-20(28)34-16(5)35-22(30)15(3)4/h17H,1,3,5-13H2,2,4H3,(H,24,31)(H,25,26) |
| InChIKey | GGAZUWAISOGNHK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 180.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|