C26H43N3O10S — CID 59248469
2-[[3-[3-[2-(diethylamino)ethoxy]-3-oxopropyl]sulfanyl-2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]propoxy]carbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 59248469) has the molecular formula C26H43N3O10S and a molecular weight of 589.71 g/mol. Its IUPAC name is 2-[[3-[3-[2-(diethylamino)ethoxy]-3-oxopropyl]sulfanyl-2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]propoxy]carbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[3-[3-[2-(diethylamino)ethoxy]-3-oxopropyl]sulfanyl-2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]propoxy]carbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59248469 |
| Molecular Formula | C26H43N3O10S |
| Molecular Weight | 589.71 g/mol |
| Exact Mass | 589.27 |
| IUPAC Name | 2-[[3-[3-[2-(diethylamino)ethoxy]-3-oxopropyl]sulfanyl-2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxy]propoxy]carbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCC(CSCCC(=O)OCCN(CC)CC)OC(=O)NCCOC(=O)C(=C)C |
| InChI | InChI=1S/C26H43N3O10S/c1-7-29(8-2)12-15-35-22(30)9-16-40-18-21(39-26(34)28-11-14-37-24(32)20(5)6)17-38-25(33)27-10-13-36-23(31)19(3)4/h21H,3,5,7-18H2,1-2,4,6H3,(H,27,33)(H,28,34) |
| InChIKey | CZEBOUPUNTWZBL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 158.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.71 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|