C11H21NO6S — CID 21395631
2-(hexanoylamino)-2-(sulfomethyl)butanoic acid (PubChem CID 21395631) has the molecular formula C11H21NO6S and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-(hexanoylamino)-2-(sulfomethyl)butanoic acid.
| Compound Name | 2-(hexanoylamino)-2-(sulfomethyl)butanoic acid |
|---|---|
| PubChem CID | 21395631 |
| Molecular Formula | C11H21NO6S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-(hexanoylamino)-2-(sulfomethyl)butanoic acid |
| SMILES | CCCCCC(=O)NC(CC)(CS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C11H21NO6S/c1-3-5-6-7-9(13)12-11(4-2,10(14)15)8-19(16,17)18/h3-8H2,1-2H3,(H,12,13)(H,14,15)(H,16,17,18) |
| InChIKey | ASJOCOWPOGGXEQ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|