C16H27NO7 — CID 102045445
4-(2-carboxyethyl)-4-(hexanoylamino)heptanedioic acid (PubChem CID 102045445) has the molecular formula C16H27NO7 and a molecular weight of 345.39 g/mol. Its IUPAC name is 4-(2-carboxyethyl)-4-(hexanoylamino)heptanedioic acid.
| Compound Name | 4-(2-carboxyethyl)-4-(hexanoylamino)heptanedioic acid |
|---|---|
| PubChem CID | 102045445 |
| Molecular Formula | C16H27NO7 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 4-(2-carboxyethyl)-4-(hexanoylamino)heptanedioic acid |
| SMILES | CCCCCC(=O)NC(CCC(=O)O)(CCC(=O)O)CCC(=O)O |
| InChI | InChI=1S/C16H27NO7/c1-2-3-4-5-12(18)17-16(9-6-13(19)20,10-7-14(21)22)11-8-15(23)24/h2-11H2,1H3,(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | WGRVWFDFDRRZDH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|