C16H28N2O7 — CID 146233912
4-(6-aminohexanoylamino)-4-(2-carboxyethyl)heptanedioic acid (PubChem CID 146233912) has the molecular formula C16H28N2O7 and a molecular weight of 360.41 g/mol. Its IUPAC name is 4-(6-aminohexanoylamino)-4-(2-carboxyethyl)heptanedioic acid.
| Compound Name | 4-(6-aminohexanoylamino)-4-(2-carboxyethyl)heptanedioic acid |
|---|---|
| PubChem CID | 146233912 |
| Molecular Formula | C16H28N2O7 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 4-(6-aminohexanoylamino)-4-(2-carboxyethyl)heptanedioic acid |
| SMILES | NCCCCCC(=O)NC(CCC(=O)O)(CCC(=O)O)CCC(=O)O |
| InChI | InChI=1S/C16H28N2O7/c17-11-3-1-2-4-12(19)18-16(8-5-13(20)21,9-6-14(22)23)10-7-15(24)25/h1-11,17H2,(H,18,19)(H,20,21)(H,22,23)(H,24,25) |
| InChIKey | SFMOCPGVFMWVIJ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 167.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|