C9H22NNaO3S — CID 173281045
sodium;hydride;2-methyl-2-(pentylamino)propane-1-sulfonic acid (PubChem CID 173281045) has the molecular formula C9H22NNaO3S and a molecular weight of 247.34 g/mol. Its IUPAC name is sodium;hydride;2-methyl-2-(pentylamino)propane-1-sulfonic acid.
| Compound Name | sodium;hydride;2-methyl-2-(pentylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 173281045 |
| Molecular Formula | C9H22NNaO3S |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | sodium;hydride;2-methyl-2-(pentylamino)propane-1-sulfonic acid |
| SMILES | CCCCCNC(C)(C)CS(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C9H21NO3S.Na.H/c1-4-5-6-7-10-9(2,3)8-14(11,12)13;;/h10H,4-8H2,1-3H3,(H,11,12,13);;/q;+1;-1 |
| InChIKey | VZTKSYVRBRAKHR-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|