C9H24N2O3S — CID 173312698
azane;2-methyl-2-(pentylamino)propane-1-sulfonic acid (PubChem CID 173312698) has the molecular formula C9H24N2O3S and a molecular weight of 240.37 g/mol. Its IUPAC name is azane;2-methyl-2-(pentylamino)propane-1-sulfonic acid.
| Compound Name | azane;2-methyl-2-(pentylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 173312698 |
| Molecular Formula | C9H24N2O3S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | azane;2-methyl-2-(pentylamino)propane-1-sulfonic acid |
| SMILES | CCCCCNC(C)(C)CS(=O)(=O)O.N |
| InChI | InChI=1S/C9H21NO3S.H3N/c1-4-5-6-7-10-9(2,3)8-14(11,12)13;/h10H,4-8H2,1-3H3,(H,11,12,13);1H3 |
| InChIKey | UHSNXPNSZXCRCV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|