C18H35NO6S — CID 23528087
2-[(5-butoxy-2-ethyl-2,4,4-trimethyl-5-oxopentanoyl)amino]-2-methylpropane-1-sulfonic acid (PubChem CID 23528087) has the molecular formula C18H35NO6S and a molecular weight of 393.55 g/mol. Its IUPAC name is 2-[(5-butoxy-2-ethyl-2,4,4-trimethyl-5-oxopentanoyl)amino]-2-methylpropane-1-sulfonic acid.
| Compound Name | 2-[(5-butoxy-2-ethyl-2,4,4-trimethyl-5-oxopentanoyl)amino]-2-methylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 23528087 |
| Molecular Formula | C18H35NO6S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 2-[(5-butoxy-2-ethyl-2,4,4-trimethyl-5-oxopentanoyl)amino]-2-methylpropane-1-sulfonic acid |
| SMILES | CCCCOC(=O)C(C)(C)CC(C)(CC)C(=O)NC(C)(C)CS(=O)(=O)O |
| InChI | InChI=1S/C18H35NO6S/c1-8-10-11-25-15(21)16(3,4)12-18(7,9-2)14(20)19-17(5,6)13-26(22,23)24/h8-13H2,1-7H3,(H,19,20)(H,22,23,24) |
| InChIKey | YNWDIWXIOFDHFV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|