C31H65N2OP — CID 166084880
2-methyl-2-nonyl-N-[2,5,5-trimethyl-6-(phosphanylamino)heptan-2-yl]undecanamide (PubChem CID 166084880) has the molecular formula C31H65N2OP and a molecular weight of 512.85 g/mol. Its IUPAC name is 2-methyl-2-nonyl-N-[2,5,5-trimethyl-6-(phosphanylamino)heptan-2-yl]undecanamide.
| Compound Name | 2-methyl-2-nonyl-N-[2,5,5-trimethyl-6-(phosphanylamino)heptan-2-yl]undecanamide |
|---|---|
| PubChem CID | 166084880 |
| Molecular Formula | C31H65N2OP |
| Molecular Weight | 512.85 g/mol |
| Exact Mass | 512.48 |
| IUPAC Name | 2-methyl-2-nonyl-N-[2,5,5-trimethyl-6-(phosphanylamino)heptan-2-yl]undecanamide |
| SMILES | CCCCCCCCCC(C)(CCCCCCCCC)C(=O)NC(C)(C)CCC(C)(C)C(C)NP |
| InChI | InChI=1S/C31H65N2OP/c1-9-11-13-15-17-19-21-23-31(8,24-22-20-18-16-14-12-10-2)28(34)32-30(6,7)26-25-29(4,5)27(3)33-35/h27,33H,9-26,35H2,1-8H3,(H,32,34) |
| InChIKey | GANUHHSUSCSCOU-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.85 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|