C33H52NO8P — CID 154573149
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-tetradeca-3,6,9,12-tetraenoyloxypropan-2-yl] tetradeca-3,6,9-trienoate (PubChem CID 154573149) has the molecular formula C33H52NO8P and a molecular weight of 621.75 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-tetradeca-3,6,9,12-tetraenoyloxypropan-2-yl] tetradeca-3,6,9-trienoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-tetradeca-3,6,9,12-tetraenoyloxypropan-2-yl] tetradeca-3,6,9-trienoate |
|---|---|
| PubChem CID | 154573149 |
| Molecular Formula | C33H52NO8P |
| Molecular Weight | 621.75 g/mol |
| Exact Mass | 621.34 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-tetradeca-3,6,9,12-tetraenoyloxypropan-2-yl] tetradeca-3,6,9-trienoate |
| SMILES | CC=CCC=CCC=CCC=CCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CC=CCC=CCC=CCCCC |
| InChI | InChI=1S/C33H52NO8P/c1-3-5-7-9-11-13-15-17-19-21-23-25-32(35)39-29-31(30-41-43(37,38)40-28-27-34)42-33(36)26-24-22-20-18-16-14-12-10-8-6-4-2/h3,5,9-12,15-18,21-24,31H,4,6-8,13-14,19-20,25-30,34H2,1-2H3,(H,37,38)/t31-/m1/s1 |
| InChIKey | YCVHDSFJTGKQRQ-WJOKGBTCSA-N |
| XLogP | 7.37 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.75 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|