C39H72NO8P — CID 162805205
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-tetradec-9-enoyloxypropan-2-yl] icosa-11,14-dienoate (PubChem CID 162805205) has the molecular formula C39H72NO8P and a molecular weight of 713.98 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-tetradec-9-enoyloxypropan-2-yl] icosa-11,14-dienoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-tetradec-9-enoyloxypropan-2-yl] icosa-11,14-dienoate |
|---|---|
| PubChem CID | 162805205 |
| Molecular Formula | C39H72NO8P |
| Molecular Weight | 713.98 g/mol |
| Exact Mass | 713.50 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-tetradec-9-enoyloxypropan-2-yl] icosa-11,14-dienoate |
| SMILES | CCCCC=CCCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CCCCCCCCCC=CCC=CCCCCC |
| InChI | InChI=1S/C39H72NO8P/c1-3-5-7-9-11-13-15-16-17-18-19-20-22-24-26-28-30-32-39(42)48-37(36-47-49(43,44)46-34-33-40)35-45-38(41)31-29-27-25-23-21-14-12-10-8-6-4-2/h10-13,16-17,37H,3-9,14-15,18-36,40H2,1-2H3,(H,43,44)/t37-/m1/s1 |
| InChIKey | QEPGPOLSCPMSDZ-DIPNUNPCSA-N |
| XLogP | 10.60 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.98 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|