C43H76NO8P — CID 75957603
[3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-octadeca-9,12-dienoyloxypropyl] icosa-8,11,14-trienoate (PubChem CID 75957603) has the molecular formula C43H76NO8P and a molecular weight of 766.05 g/mol. Its IUPAC name is [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-octadeca-9,12-dienoyloxypropyl] icosa-8,11,14-trienoate.
| Compound Name | [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-octadeca-9,12-dienoyloxypropyl] icosa-8,11,14-trienoate |
|---|---|
| PubChem CID | 75957603 |
| Molecular Formula | C43H76NO8P |
| Molecular Weight | 766.05 g/mol |
| Exact Mass | 765.53 |
| IUPAC Name | [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-octadeca-9,12-dienoyloxypropyl] icosa-8,11,14-trienoate |
| SMILES | CCCCCC=CCC=CCC=CCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCCCCCC=CCC=CCCCCC |
| InChI | InChI=1S/C43H76NO8P/c1-3-5-7-9-11-13-15-17-19-20-22-23-25-27-29-31-33-35-42(45)49-39-41(40-51-53(47,48)50-38-37-44)52-43(46)36-34-32-30-28-26-24-21-18-16-14-12-10-8-6-4-2/h11-14,17-19,21-23,41H,3-10,15-16,20,24-40,44H2,1-2H3,(H,47,48) |
| InChIKey | IFXHBQGHSNUBCV-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.05 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|