C33H62NO8P — CID 134729107
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-decanoyloxypropan-2-yl] (6E,9E)-octadeca-6,9-dienoate (PubChem CID 134729107) has the molecular formula C33H62NO8P and a molecular weight of 631.83 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-decanoyloxypropan-2-yl] (6E,9E)-octadeca-6,9-dienoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-decanoyloxypropan-2-yl] (6E,9E)-octadeca-6,9-dienoate |
|---|---|
| PubChem CID | 134729107 |
| Molecular Formula | C33H62NO8P |
| Molecular Weight | 631.83 g/mol |
| Exact Mass | 631.42 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-decanoyloxypropan-2-yl] (6E,9E)-octadeca-6,9-dienoate |
| SMILES | CCCCCCCC/C=C/C/C=C/CCCCC(=O)O[C@H](COC(=O)CCCCCCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C33H62NO8P/c1-3-5-7-9-11-12-13-14-15-16-17-18-20-22-24-26-33(36)42-31(30-41-43(37,38)40-28-27-34)29-39-32(35)25-23-21-19-10-8-6-4-2/h14-15,17-18,31H,3-13,16,19-30,34H2,1-2H3,(H,37,38)/b15-14+,18-17+/t31-/m1/s1 |
| InChIKey | FDVJNRYZZRQMOQ-NHNUEECSSA-N |
| XLogP | 8.49 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.83 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|