C40H74NO8P — CID 134718648
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(9E,12E)-heptadeca-9,12-dienoyl]oxypropan-2-yl] (E)-octadec-7-enoate (PubChem CID 134718648) has the molecular formula C40H74NO8P and a molecular weight of 728.00 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(9E,12E)-heptadeca-9,12-dienoyl]oxypropan-2-yl] (E)-octadec-7-enoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(9E,12E)-heptadeca-9,12-dienoyl]oxypropan-2-yl] (E)-octadec-7-enoate |
|---|---|
| PubChem CID | 134718648 |
| Molecular Formula | C40H74NO8P |
| Molecular Weight | 728.00 g/mol |
| Exact Mass | 727.52 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(9E,12E)-heptadeca-9,12-dienoyl]oxypropan-2-yl] (E)-octadec-7-enoate |
| SMILES | CCCC/C=C/C/C=C/CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CCCCC/C=C/CCCCCCCCCC |
| InChI | InChI=1S/C40H74NO8P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-40(43)49-38(37-48-50(44,45)47-35-34-41)36-46-39(42)32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h10,12,16,18,21,23,38H,3-9,11,13-15,17,19-20,22,24-37,41H2,1-2H3,(H,44,45)/b12-10+,18-16+,23-21+/t38-/m1/s1 |
| InChIKey | ALSVJIXVTKWXOV-KGRCHOBYSA-N |
| XLogP | 10.99 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.00 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|